C43H35N — CID 101463001
N,1-bis[4-(9,9-dimethylfluoren-2-yl)phenyl]methanimine (PubChem CID 101463001) has the molecular formula C43H35N and a molecular weight of 565.76 g/mol. Its IUPAC name is N,1-bis[4-(9,9-dimethylfluoren-2-yl)phenyl]methanimine.
| Compound Name | N,1-bis[4-(9,9-dimethylfluoren-2-yl)phenyl]methanimine |
|---|---|
| PubChem CID | 101463001 |
| Molecular Formula | C43H35N |
| Molecular Weight | 565.76 g/mol |
| Exact Mass | 565.28 |
| IUPAC Name | N,1-bis[4-(9,9-dimethylfluoren-2-yl)phenyl]methanimine |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3ccc(/C=N/c4ccc(-c5ccc6c(c5)C(C)(C)c5ccccc5-6)cc4)cc3)cc21 |
| InChI | InChI=1S/C43H35N/c1-42(2)38-11-7-5-9-34(38)36-23-19-31(25-40(36)42)29-15-13-28(14-16-29)27-44-33-21-17-30(18-22-33)32-20-24-37-35-10-6-8-12-39(35)43(3,4)41(37)26-32/h5-27H,1-4H3/b44-27+ |
| InChIKey | NTFOXPXLFRSYBD-ZSTTVQMRSA-N |
| XLogP | 11.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.76 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|