C26H24FN3O — CID 70953315
(Z)-3-amino-2-[[4-(2-cyanophenyl)phenyl]methyl]-N-(4-fluorophenyl)hex-2-enamide (PubChem CID 70953315) has the molecular formula C26H24FN3O and a molecular weight of 413.50 g/mol. Its IUPAC name is (Z)-3-amino-2-[[4-(2-cyanophenyl)phenyl]methyl]-N-(4-fluorophenyl)hex-2-enamide.
| Compound Name | (Z)-3-amino-2-[[4-(2-cyanophenyl)phenyl]methyl]-N-(4-fluorophenyl)hex-2-enamide |
|---|---|
| PubChem CID | 70953315 |
| Molecular Formula | C26H24FN3O |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | (Z)-3-amino-2-[[4-(2-cyanophenyl)phenyl]methyl]-N-(4-fluorophenyl)hex-2-enamide |
| SMILES | CCC/C(N)=C(\Cc1ccc(-c2ccccc2C#N)cc1)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C26H24FN3O/c1-2-5-25(29)24(26(31)30-22-14-12-21(27)13-15-22)16-18-8-10-19(11-9-18)23-7-4-3-6-20(23)17-28/h3-4,6-15H,2,5,16,29H2,1H3,(H,30,31)/b25-24- |
| InChIKey | CYYKADBTAPXNIS-IZHYLOQSSA-N |
| XLogP | 5.56 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|