C22H22ClNO3 — CID 57460894
ethyl 2-[[3-chloro-4-(2-cyanophenyl)phenyl]methyl]-3-oxohexanoate (PubChem CID 57460894) has the molecular formula C22H22ClNO3 and a molecular weight of 383.88 g/mol. Its IUPAC name is ethyl 2-[[3-chloro-4-(2-cyanophenyl)phenyl]methyl]-3-oxohexanoate.
| Compound Name | ethyl 2-[[3-chloro-4-(2-cyanophenyl)phenyl]methyl]-3-oxohexanoate |
|---|---|
| PubChem CID | 57460894 |
| Molecular Formula | C22H22ClNO3 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | ethyl 2-[[3-chloro-4-(2-cyanophenyl)phenyl]methyl]-3-oxohexanoate |
| SMILES | CCCC(=O)C(Cc1ccc(-c2ccccc2C#N)c(Cl)c1)C(=O)OCC |
| InChI | InChI=1S/C22H22ClNO3/c1-3-7-21(25)19(22(26)27-4-2)12-15-10-11-18(20(23)13-15)17-9-6-5-8-16(17)14-24/h5-6,8-11,13,19H,3-4,7,12H2,1-2H3 |
| InChIKey | DYKZYCFYMZVSGW-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|