C23H22F3NO3 — CID 67008441
ethyl 2-[[4-(2-cyanophenyl)-2-(trifluoromethyl)phenyl]methyl]-3-oxohexanoate (PubChem CID 67008441) has the molecular formula C23H22F3NO3 and a molecular weight of 417.43 g/mol. Its IUPAC name is ethyl 2-[[4-(2-cyanophenyl)-2-(trifluoromethyl)phenyl]methyl]-3-oxohexanoate.
| Compound Name | ethyl 2-[[4-(2-cyanophenyl)-2-(trifluoromethyl)phenyl]methyl]-3-oxohexanoate |
|---|---|
| PubChem CID | 67008441 |
| Molecular Formula | C23H22F3NO3 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | ethyl 2-[[4-(2-cyanophenyl)-2-(trifluoromethyl)phenyl]methyl]-3-oxohexanoate |
| SMILES | CCCC(=O)C(Cc1ccc(-c2ccccc2C#N)cc1C(F)(F)F)C(=O)OCC |
| InChI | InChI=1S/C23H22F3NO3/c1-3-7-21(28)19(22(29)30-4-2)12-16-11-10-15(13-20(16)23(24,25)26)18-9-6-5-8-17(18)14-27/h5-6,8-11,13,19H,3-4,7,12H2,1-2H3 |
| InChIKey | CXVIEZKIXIDUAD-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|