C26H31NO4 — CID 18958911
ethyl 2-[[4-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]phenyl]methyl]-3-oxohexanoate (PubChem CID 18958911) has the molecular formula C26H31NO4 and a molecular weight of 421.54 g/mol. Its IUPAC name is ethyl 2-[[4-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]phenyl]methyl]-3-oxohexanoate.
| Compound Name | ethyl 2-[[4-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]phenyl]methyl]-3-oxohexanoate |
|---|---|
| PubChem CID | 18958911 |
| Molecular Formula | C26H31NO4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | ethyl 2-[[4-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]phenyl]methyl]-3-oxohexanoate |
| SMILES | CCCC(=O)C(Cc1ccc(-c2ccccc2C2=NC(C)(C)CO2)cc1)C(=O)OCC |
| InChI | InChI=1S/C26H31NO4/c1-5-9-23(28)22(25(29)30-6-2)16-18-12-14-19(15-13-18)20-10-7-8-11-21(20)24-27-26(3,4)17-31-24/h7-8,10-15,22H,5-6,9,16-17H2,1-4H3 |
| InChIKey | AKAYRRQMASYJCU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|