C18H18F3NO2 — CID 170885356
ethyl 2-amino-3-[4-[2-(trifluoromethyl)phenyl]phenyl]propanoate (PubChem CID 170885356) has the molecular formula C18H18F3NO2 and a molecular weight of 337.34 g/mol. Its IUPAC name is ethyl 2-amino-3-[4-[2-(trifluoromethyl)phenyl]phenyl]propanoate.
| Compound Name | ethyl 2-amino-3-[4-[2-(trifluoromethyl)phenyl]phenyl]propanoate |
|---|---|
| PubChem CID | 170885356 |
| Molecular Formula | C18H18F3NO2 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | ethyl 2-amino-3-[4-[2-(trifluoromethyl)phenyl]phenyl]propanoate |
| SMILES | CCOC(=O)C(N)Cc1ccc(-c2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H18F3NO2/c1-2-24-17(23)16(22)11-12-7-9-13(10-8-12)14-5-3-4-6-15(14)18(19,20)21/h3-10,16H,2,11,22H2,1H3 |
| InChIKey | CYZZRMGOMVCYSW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |