C18H17F3O2 — CID 67555749
4-hydroxy-1-[4-[2-(trifluoromethyl)phenyl]phenyl]pentan-3-one (PubChem CID 67555749) has the molecular formula C18H17F3O2 and a molecular weight of 322.33 g/mol. Its IUPAC name is 4-hydroxy-1-[4-[2-(trifluoromethyl)phenyl]phenyl]pentan-3-one.
| Compound Name | 4-hydroxy-1-[4-[2-(trifluoromethyl)phenyl]phenyl]pentan-3-one |
|---|---|
| PubChem CID | 67555749 |
| Molecular Formula | C18H17F3O2 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 4-hydroxy-1-[4-[2-(trifluoromethyl)phenyl]phenyl]pentan-3-one |
| SMILES | CC(O)C(=O)CCc1ccc(-c2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H17F3O2/c1-12(22)17(23)11-8-13-6-9-14(10-7-13)15-4-2-3-5-16(15)18(19,20)21/h2-7,9-10,12,22H,8,11H2,1H3 |
| InChIKey | TUWDOZMKVROAGL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |