C18H21F3N2O4S — CID 175034702
methanesulfonic acid;2-[[4-[2-(trifluoromethyl)phenyl]phenyl]methylamino]propanamide (PubChem CID 175034702) has the molecular formula C18H21F3N2O4S and a molecular weight of 418.44 g/mol. Its IUPAC name is methanesulfonic acid;2-[[4-[2-(trifluoromethyl)phenyl]phenyl]methylamino]propanamide.
| Compound Name | methanesulfonic acid;2-[[4-[2-(trifluoromethyl)phenyl]phenyl]methylamino]propanamide |
|---|---|
| PubChem CID | 175034702 |
| Molecular Formula | C18H21F3N2O4S |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | methanesulfonic acid;2-[[4-[2-(trifluoromethyl)phenyl]phenyl]methylamino]propanamide |
| SMILES | CC(NCc1ccc(-c2ccccc2C(F)(F)F)cc1)C(N)=O.CS(=O)(=O)O |
| InChI | InChI=1S/C17H17F3N2O.CH4O3S/c1-11(16(21)23)22-10-12-6-8-13(9-7-12)14-4-2-3-5-15(14)17(18,19)20;1-5(2,3)4/h2-9,11,22H,10H2,1H3,(H2,21,23);1H3,(H,2,3,4) |
| InChIKey | PFXUTWDOOFMXKV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|