C19H23F3N2O5S — CID 166633388
methanesulfonic acid;2-[2-[4-[4-(trifluoromethoxy)phenyl]phenyl]ethylamino]propanamide (PubChem CID 166633388) has the molecular formula C19H23F3N2O5S and a molecular weight of 448.46 g/mol. Its IUPAC name is methanesulfonic acid;2-[2-[4-[4-(trifluoromethoxy)phenyl]phenyl]ethylamino]propanamide.
| Compound Name | methanesulfonic acid;2-[2-[4-[4-(trifluoromethoxy)phenyl]phenyl]ethylamino]propanamide |
|---|---|
| PubChem CID | 166633388 |
| Molecular Formula | C19H23F3N2O5S |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | methanesulfonic acid;2-[2-[4-[4-(trifluoromethoxy)phenyl]phenyl]ethylamino]propanamide |
| SMILES | CC(NCCc1ccc(-c2ccc(OC(F)(F)F)cc2)cc1)C(N)=O.CS(=O)(=O)O |
| InChI | InChI=1S/C18H19F3N2O2.CH4O3S/c1-12(17(22)24)23-11-10-13-2-4-14(5-3-13)15-6-8-16(9-7-15)25-18(19,20)21;1-5(2,3)4/h2-9,12,23H,10-11H2,1H3,(H2,22,24);1H3,(H,2,3,4) |
| InChIKey | REMJFIPZCSJCGS-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|