C10H13BrN2O — CID 43402314
2-[(4-bromophenyl)methylamino]propanamide (PubChem CID 43402314) has the molecular formula C10H13BrN2O and a molecular weight of 257.13 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methylamino]propanamide.
| Compound Name | 2-[(4-bromophenyl)methylamino]propanamide |
|---|---|
| PubChem CID | 43402314 |
| Molecular Formula | C10H13BrN2O |
| Molecular Weight | 257.13 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 2-[(4-bromophenyl)methylamino]propanamide |
| SMILES | CC(NCc1ccc(Br)cc1)C(N)=O |
| InChI | InChI=1S/C10H13BrN2O/c1-7(10(12)14)13-6-8-2-4-9(11)5-3-8/h2-5,7,13H,6H2,1H3,(H2,12,14) |
| InChIKey | VLVSZKLLMVJVEV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.13 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |