C10H13N3O3 — CID 43402378
2-[(4-nitrophenyl)methylamino]propanamide (PubChem CID 43402378) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is 2-[(4-nitrophenyl)methylamino]propanamide.
| Compound Name | 2-[(4-nitrophenyl)methylamino]propanamide |
|---|---|
| PubChem CID | 43402378 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 2-[(4-nitrophenyl)methylamino]propanamide |
| SMILES | CC(NCc1ccc([N+](=O)[O-])cc1)C(N)=O |
| InChI | InChI=1S/C10H13N3O3/c1-7(10(11)14)12-6-8-2-4-9(5-3-8)13(15)16/h2-5,7,12H,6H2,1H3,(H2,11,14) |
| InChIKey | MJUVKIXIOYZFHQ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|