C28H29N5O3 — CID 59718057
benzyl 2-[formyl-[[4-[2-(1-methyltetrazol-5-yl)phenyl]phenyl]methyl]amino]-3-methylbutanoate (PubChem CID 59718057) has the molecular formula C28H29N5O3 and a molecular weight of 483.57 g/mol. Its IUPAC name is benzyl 2-[formyl-[[4-[2-(1-methyltetrazol-5-yl)phenyl]phenyl]methyl]amino]-3-methylbutanoate.
| Compound Name | benzyl 2-[formyl-[[4-[2-(1-methyltetrazol-5-yl)phenyl]phenyl]methyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 59718057 |
| Molecular Formula | C28H29N5O3 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | benzyl 2-[formyl-[[4-[2-(1-methyltetrazol-5-yl)phenyl]phenyl]methyl]amino]-3-methylbutanoate |
| SMILES | CC(C)C(C(=O)OCc1ccccc1)N(C=O)Cc1ccc(-c2ccccc2-c2nnnn2C)cc1 |
| InChI | InChI=1S/C28H29N5O3/c1-20(2)26(28(35)36-18-22-9-5-4-6-10-22)33(19-34)17-21-13-15-23(16-14-21)24-11-7-8-12-25(24)27-29-30-31-32(27)3/h4-16,19-20,26H,17-18H2,1-3H3 |
| InChIKey | KTMKQIIJQOPMGY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 90.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|