About (3-methylphenyl)methyl 4-(1-methyltetrazol-5-yl)benzoate
(3-methylphenyl)methyl 4-(1-methyltetrazol-5-yl)benzoate (PubChem CID 23541004) has the molecular formula C17H16N4O2
and a molecular weight of 308.34 g/mol. Its IUPAC name is (3-methylphenyl)methyl 4-(1-methyltetrazol-5-yl)benzoate.
Molecular Properties
| Compound Name | (3-methylphenyl)methyl 4-(1-methyltetrazol-5-yl)benzoate |
| PubChem CID | 23541004 |
| Molecular Formula | C17H16N4O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (3-methylphenyl)methyl 4-(1-methyltetrazol-5-yl)benzoate |
| SMILES | Cc1cccc(COC(=O)c2ccc(-c3nnnn3C)cc2)c1 |
| InChI | InChI=1S/C17H16N4O2/c1-12-4-3-5-13(10-12)11-23-17(22)15-8-6-14(7-9-15)16-18-19-20-21(16)2/h3-10H,11H2,1-2H3 |
| InChIKey | HHVPYJCQZSUEBN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3-methylphenyl)methyl 4-(1-methyltetrazol-5-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylphenyl)methyl 4-(1-methyltetrazol-5-yl)benzoate?
The IUPAC name of (3-methylphenyl)methyl 4-(1-methyltetrazol-5-yl)benzoate (CID 23541004) is (3-methylphenyl)methyl 4-(1-methyltetrazol-5-yl)benzoate.
What is the SMILES notation for (3-methylphenyl)methyl 4-(1-methyltetrazol-5-yl)benzoate?
The canonical SMILES for (3-methylphenyl)methyl 4-(1-methyltetrazol-5-yl)benzoate is Cc1cccc(COC(=O)c2ccc(-c3nnnn3C)cc2)c1.
What is the InChIKey of (3-methylphenyl)methyl 4-(1-methyltetrazol-5-yl)benzoate?
The InChIKey is HHVPYJCQZSUEBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4O2/c1-12-4-3-5-13(10-12)11-23-17(22)15-8-6-14(7-9-15)16-18-19-20-21(16)2/h3-10H,11H2,1-2H3.
What are the key properties of (3-methylphenyl)methyl 4-(1-methyltetrazol-5-yl)benzoate?
(3-methylphenyl)methyl 4-(1-methyltetrazol-5-yl)benzoate has a molecular weight of 308.34 g/mol, XLogP of 2.54, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylphenyl)methyl 4-(1-methyltetrazol-5-yl)benzoate is sourced from PubChem (CID 23541004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).