C33H37N5O5 — CID 91295051
methyl (2S)-3-methyl-2-[[4-[2-(1-pentanoyltetrazol-5-yl)phenyl]phenyl]methyl-phenylmethoxycarbonylamino]butanoate (PubChem CID 91295051) has the molecular formula C33H37N5O5 and a molecular weight of 583.69 g/mol. Its IUPAC name is methyl (2S)-3-methyl-2-[[4-[2-(1-pentanoyltetrazol-5-yl)phenyl]phenyl]methyl-phenylmethoxycarbonylamino]butanoate.
| Compound Name | methyl (2S)-3-methyl-2-[[4-[2-(1-pentanoyltetrazol-5-yl)phenyl]phenyl]methyl-phenylmethoxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 91295051 |
| Molecular Formula | C33H37N5O5 |
| Molecular Weight | 583.69 g/mol |
| Exact Mass | 583.28 |
| IUPAC Name | methyl (2S)-3-methyl-2-[[4-[2-(1-pentanoyltetrazol-5-yl)phenyl]phenyl]methyl-phenylmethoxycarbonylamino]butanoate |
| SMILES | CCCCC(=O)n1nnnc1-c1ccccc1-c1ccc(CN(C(=O)OCc2ccccc2)[C@H](C(=O)OC)C(C)C)cc1 |
| InChI | InChI=1S/C33H37N5O5/c1-5-6-16-29(39)38-31(34-35-36-38)28-15-11-10-14-27(28)26-19-17-24(18-20-26)21-37(30(23(2)3)32(40)42-4)33(41)43-22-25-12-8-7-9-13-25/h7-15,17-20,23,30H,5-6,16,21-22H2,1-4H3/t30-/m0/s1 |
| InChIKey | GXJKDSHXYXDMIH-PMERELPUSA-N |
| XLogP | 6.17 |
| TPSA | 116.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.69 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'} |
|---|