C24H29N5O3 — CID 11626241
(2S)-3-methyl-2-[[4-[2-(1-pentanoyltetrazol-5-yl)phenyl]phenyl]methylamino]butanoic acid (PubChem CID 11626241) has the molecular formula C24H29N5O3 and a molecular weight of 435.53 g/mol. Its IUPAC name is (2S)-3-methyl-2-[[4-[2-(1-pentanoyltetrazol-5-yl)phenyl]phenyl]methylamino]butanoic acid.
| Compound Name | (2S)-3-methyl-2-[[4-[2-(1-pentanoyltetrazol-5-yl)phenyl]phenyl]methylamino]butanoic acid |
|---|---|
| PubChem CID | 11626241 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | (2S)-3-methyl-2-[[4-[2-(1-pentanoyltetrazol-5-yl)phenyl]phenyl]methylamino]butanoic acid |
| SMILES | CCCCC(=O)n1nnnc1-c1ccccc1-c1ccc(CN[C@H](C(=O)O)C(C)C)cc1 |
| InChI | InChI=1S/C24H29N5O3/c1-4-5-10-21(30)29-23(26-27-28-29)20-9-7-6-8-19(20)18-13-11-17(12-14-18)15-25-22(16(2)3)24(31)32/h6-9,11-14,16,22,25H,4-5,10,15H2,1-3H3,(H,31,32)/t22-/m0/s1 |
| InChIKey | GDSUITFDSXSSHD-QFIPXVFZSA-N |
| XLogP | 4.04 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'} |
|---|