C22H23N7OS — CID 19029490
1-[5-[2-[4-[[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]methyl]phenyl]phenyl]tetrazol-1-yl]butan-1-one (PubChem CID 19029490) has the molecular formula C22H23N7OS and a molecular weight of 433.54 g/mol. Its IUPAC name is 1-[5-[2-[4-[[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]methyl]phenyl]phenyl]tetrazol-1-yl]butan-1-one.
| Compound Name | 1-[5-[2-[4-[[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]methyl]phenyl]phenyl]tetrazol-1-yl]butan-1-one |
|---|---|
| PubChem CID | 19029490 |
| Molecular Formula | C22H23N7OS |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 1-[5-[2-[4-[[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]methyl]phenyl]phenyl]tetrazol-1-yl]butan-1-one |
| SMILES | CCCC(=O)n1nnnc1-c1ccccc1-c1ccc(CNc2nnc(CC)s2)cc1 |
| InChI | InChI=1S/C22H23N7OS/c1-3-7-20(30)29-21(25-27-28-29)18-9-6-5-8-17(18)16-12-10-15(11-13-16)14-23-22-26-24-19(4-2)31-22/h5-6,8-13H,3-4,7,14H2,1-2H3,(H,23,26) |
| InChIKey | BEEYSYZAEUAZBO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'} |
|---|