C30H30N6O4 — CID 139684042
1-[benzoyl-[[4-[2-(1-butanoyltetrazol-5-yl)phenyl]phenyl]methyl]amino]pyrrolidine-2-carboxylic acid (PubChem CID 139684042) has the molecular formula C30H30N6O4 and a molecular weight of 538.61 g/mol. Its IUPAC name is 1-[benzoyl-[[4-[2-(1-butanoyltetrazol-5-yl)phenyl]phenyl]methyl]amino]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[benzoyl-[[4-[2-(1-butanoyltetrazol-5-yl)phenyl]phenyl]methyl]amino]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 139684042 |
| Molecular Formula | C30H30N6O4 |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 538.23 |
| IUPAC Name | 1-[benzoyl-[[4-[2-(1-butanoyltetrazol-5-yl)phenyl]phenyl]methyl]amino]pyrrolidine-2-carboxylic acid |
| SMILES | CCCC(=O)n1nnnc1-c1ccccc1-c1ccc(CN(C(=O)c2ccccc2)N2CCCC2C(=O)O)cc1 |
| InChI | InChI=1S/C30H30N6O4/c1-2-9-27(37)36-28(31-32-33-36)25-13-7-6-12-24(25)22-17-15-21(16-18-22)20-35(29(38)23-10-4-3-5-11-23)34-19-8-14-26(34)30(39)40/h3-7,10-13,15-18,26H,2,8-9,14,19-20H2,1H3,(H,39,40) |
| InChIKey | QBDYARNGZMTVJQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'} |
|---|