C11H12ClN3OS — CID 107647925
2-chloro-4-[[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]methyl]phenol (PubChem CID 107647925) has the molecular formula C11H12ClN3OS and a molecular weight of 269.76 g/mol. Its IUPAC name is 2-chloro-4-[[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]methyl]phenol.
| Compound Name | 2-chloro-4-[[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]methyl]phenol |
|---|---|
| PubChem CID | 107647925 |
| Molecular Formula | C11H12ClN3OS |
| Molecular Weight | 269.76 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 2-chloro-4-[[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]methyl]phenol |
| SMILES | CCc1nnc(NCc2ccc(O)c(Cl)c2)s1 |
| InChI | InChI=1S/C11H12ClN3OS/c1-2-10-14-15-11(17-10)13-6-7-3-4-9(16)8(12)5-7/h3-5,16H,2,6H2,1H3,(H,13,15) |
| InChIKey | JZVRUIWBOZMIMO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.76 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |