About 2-ethoxy-4-[[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]methyl]phenol
2-ethoxy-4-[[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]methyl]phenol (PubChem CID 107648041) has the molecular formula C13H17N3O2S
and a molecular weight of 279.37 g/mol. Its IUPAC name is 2-ethoxy-4-[[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]methyl]phenol.
Molecular Properties
| Compound Name | 2-ethoxy-4-[[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]methyl]phenol |
| PubChem CID | 107648041 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 2-ethoxy-4-[[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]methyl]phenol |
| SMILES | CCOc1cc(CNc2nnc(CC)s2)ccc1O |
| InChI | InChI=1S/C13H17N3O2S/c1-3-12-15-16-13(19-12)14-8-9-5-6-10(17)11(7-9)18-4-2/h5-7,17H,3-4,8H2,1-2H3,(H,14,16) |
| InChIKey | ZSLLIFUHWMOUFW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-ethoxy-4-[[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-4-[[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]methyl]phenol?
The IUPAC name of 2-ethoxy-4-[[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]methyl]phenol (CID 107648041) is 2-ethoxy-4-[[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]methyl]phenol.
What is the SMILES notation for 2-ethoxy-4-[[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]methyl]phenol?
The canonical SMILES for 2-ethoxy-4-[[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]methyl]phenol is CCOc1cc(CNc2nnc(CC)s2)ccc1O.
What is the InChIKey of 2-ethoxy-4-[[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]methyl]phenol?
The InChIKey is ZSLLIFUHWMOUFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O2S/c1-3-12-15-16-13(19-12)14-8-9-5-6-10(17)11(7-9)18-4-2/h5-7,17H,3-4,8H2,1-2H3,(H,14,16).
What are the key properties of 2-ethoxy-4-[[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]methyl]phenol?
2-ethoxy-4-[[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]methyl]phenol has a molecular weight of 279.37 g/mol, XLogP of 2.82, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-4-[[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]methyl]phenol is sourced from PubChem (CID 107648041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).