C30H26N4O2 — CID 59894530
(2S)-2-methyl-3-[4-(2-trityltetrazol-5-yl)phenyl]propanoic acid (PubChem CID 59894530) has the molecular formula C30H26N4O2 and a molecular weight of 474.56 g/mol. Its IUPAC name is (2S)-2-methyl-3-[4-(2-trityltetrazol-5-yl)phenyl]propanoic acid.
| Compound Name | (2S)-2-methyl-3-[4-(2-trityltetrazol-5-yl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 59894530 |
| Molecular Formula | C30H26N4O2 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | (2S)-2-methyl-3-[4-(2-trityltetrazol-5-yl)phenyl]propanoic acid |
| SMILES | C[C@@H](Cc1ccc(-c2nnn(C(c3ccccc3)(c3ccccc3)c3ccccc3)n2)cc1)C(=O)O |
| InChI | InChI=1S/C30H26N4O2/c1-22(29(35)36)21-23-17-19-24(20-18-23)28-31-33-34(32-28)30(25-11-5-2-6-12-25,26-13-7-3-8-14-26)27-15-9-4-10-16-27/h2-20,22H,21H2,1H3,(H,35,36)/t22-/m0/s1 |
| InChIKey | ZNXKHLMPGBRSGP-QFIPXVFZSA-N |
| XLogP | 5.44 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|