C23H27N5O2 — CID 163575893
tert-butyl (2S)-3-methyl-2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methylamino]but-3-enoate (PubChem CID 163575893) has the molecular formula C23H27N5O2 and a molecular weight of 405.50 g/mol. Its IUPAC name is tert-butyl (2S)-3-methyl-2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methylamino]but-3-enoate.
| Compound Name | tert-butyl (2S)-3-methyl-2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methylamino]but-3-enoate |
|---|---|
| PubChem CID | 163575893 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | tert-butyl (2S)-3-methyl-2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methylamino]but-3-enoate |
| SMILES | C=C(C)[C@H](NCc1ccc(-c2ccccc2-c2nn[nH]n2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H27N5O2/c1-15(2)20(22(29)30-23(3,4)5)24-14-16-10-12-17(13-11-16)18-8-6-7-9-19(18)21-25-27-28-26-21/h6-13,20,24H,1,14H2,2-5H3,(H,25,26,27,28)/t20-/m0/s1 |
| InChIKey | GDKVIDGYNXNMGF-FQEVSTJZSA-N |
| XLogP | 3.91 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|