C23H29N5O2 — CID 141085923
tert-butyl 2-methyl-2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methylamino]butanoate (PubChem CID 141085923) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is tert-butyl 2-methyl-2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methylamino]butanoate.
| Compound Name | tert-butyl 2-methyl-2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methylamino]butanoate |
|---|---|
| PubChem CID | 141085923 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | tert-butyl 2-methyl-2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methylamino]butanoate |
| SMILES | CCC(C)(NCc1ccc(-c2ccccc2-c2nn[nH]n2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H29N5O2/c1-6-23(5,21(29)30-22(2,3)4)24-15-16-11-13-17(14-12-16)18-9-7-8-10-19(18)20-25-27-28-26-20/h7-14,24H,6,15H2,1-5H3,(H,25,26,27,28) |
| InChIKey | OZZRVGPSQAATMW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |