C26H26N6O3 — CID 18929695
4-(pentanoylamino)-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methylamino]benzoic acid (PubChem CID 18929695) has the molecular formula C26H26N6O3 and a molecular weight of 470.53 g/mol. Its IUPAC name is 4-(pentanoylamino)-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methylamino]benzoic acid.
| Compound Name | 4-(pentanoylamino)-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methylamino]benzoic acid |
|---|---|
| PubChem CID | 18929695 |
| Molecular Formula | C26H26N6O3 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 4-(pentanoylamino)-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methylamino]benzoic acid |
| SMILES | CCCCC(=O)Nc1ccc(C(=O)O)cc1NCc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C26H26N6O3/c1-2-3-8-24(33)28-22-14-13-19(26(34)35)15-23(22)27-16-17-9-11-18(12-10-17)20-6-4-5-7-21(20)25-29-31-32-30-25/h4-7,9-15,27H,2-3,8,16H2,1H3,(H,28,33)(H,34,35)(H,29,30,31,32) |
| InChIKey | BYMPTJCHJNBGIC-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 132.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |