C18H20N6O4S — CID 118266609
3-[[4-[3-sulfamoyl-2-(2H-tetrazol-5-yl)phenyl]phenyl]methylamino]butanoic acid (PubChem CID 118266609) has the molecular formula C18H20N6O4S and a molecular weight of 416.46 g/mol. Its IUPAC name is 3-[[4-[3-sulfamoyl-2-(2H-tetrazol-5-yl)phenyl]phenyl]methylamino]butanoic acid.
| Compound Name | 3-[[4-[3-sulfamoyl-2-(2H-tetrazol-5-yl)phenyl]phenyl]methylamino]butanoic acid |
|---|---|
| PubChem CID | 118266609 |
| Molecular Formula | C18H20N6O4S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 3-[[4-[3-sulfamoyl-2-(2H-tetrazol-5-yl)phenyl]phenyl]methylamino]butanoic acid |
| SMILES | CC(CC(=O)O)NCc1ccc(-c2cccc(S(N)(=O)=O)c2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C18H20N6O4S/c1-11(9-16(25)26)20-10-12-5-7-13(8-6-12)14-3-2-4-15(29(19,27)28)17(14)18-21-23-24-22-18/h2-8,11,20H,9-10H2,1H3,(H,25,26)(H2,19,27,28)(H,21,22,23,24) |
| InChIKey | WGIIKSDGTDBXIY-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 163.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |