C17H18N6O4S — CID 118266555
2-[methyl-[[4-[3-sulfamoyl-2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]acetic acid (PubChem CID 118266555) has the molecular formula C17H18N6O4S and a molecular weight of 402.44 g/mol. Its IUPAC name is 2-[methyl-[[4-[3-sulfamoyl-2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]acetic acid.
| Compound Name | 2-[methyl-[[4-[3-sulfamoyl-2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]acetic acid |
|---|---|
| PubChem CID | 118266555 |
| Molecular Formula | C17H18N6O4S |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 2-[methyl-[[4-[3-sulfamoyl-2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]acetic acid |
| SMILES | CN(CC(=O)O)Cc1ccc(-c2cccc(S(N)(=O)=O)c2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C17H18N6O4S/c1-23(10-15(24)25)9-11-5-7-12(8-6-11)13-3-2-4-14(28(18,26)27)16(13)17-19-21-22-20-17/h2-8H,9-10H2,1H3,(H,24,25)(H2,18,26,27)(H,19,20,21,22) |
| InChIKey | QUMBBXOBPIFTKQ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 155.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |