C18H19N9O2S — CID 118265928
2-(2H-tetrazol-5-yl)-3-[4-[[2-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]phenyl]benzenesulfonamide (PubChem CID 118265928) has the molecular formula C18H19N9O2S and a molecular weight of 425.48 g/mol. Its IUPAC name is 2-(2H-tetrazol-5-yl)-3-[4-[[2-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]phenyl]benzenesulfonamide.
| Compound Name | 2-(2H-tetrazol-5-yl)-3-[4-[[2-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 118265928 |
| Molecular Formula | C18H19N9O2S |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 2-(2H-tetrazol-5-yl)-3-[4-[[2-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]phenyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(-c2ccc(CNCCc3ncn[nH]3)cc2)c1-c1nn[nH]n1 |
| InChI | InChI=1S/C18H19N9O2S/c19-30(28,29)15-3-1-2-14(17(15)18-24-26-27-25-18)13-6-4-12(5-7-13)10-20-9-8-16-21-11-22-23-16/h1-7,11,20H,8-10H2,(H2,19,28,29)(H,21,22,23)(H,24,25,26,27) |
| InChIKey | HWDAATFCCFUKOS-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 168.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|