C19H22N8O2S — CID 130230586
3-[4-[[2-(1,2-dihydroimidazol-3-yl)ethylamino]methyl]phenyl]-2-(2H-tetrazol-5-yl)benzenesulfonamide (PubChem CID 130230586) has the molecular formula C19H22N8O2S and a molecular weight of 426.51 g/mol. Its IUPAC name is 3-[4-[[2-(1,2-dihydroimidazol-3-yl)ethylamino]methyl]phenyl]-2-(2H-tetrazol-5-yl)benzenesulfonamide.
| Compound Name | 3-[4-[[2-(1,2-dihydroimidazol-3-yl)ethylamino]methyl]phenyl]-2-(2H-tetrazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 130230586 |
| Molecular Formula | C19H22N8O2S |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 3-[4-[[2-(1,2-dihydroimidazol-3-yl)ethylamino]methyl]phenyl]-2-(2H-tetrazol-5-yl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(-c2ccc(CNCCN3C=CNC3)cc2)c1-c1nn[nH]n1 |
| InChI | InChI=1S/C19H22N8O2S/c20-30(28,29)17-3-1-2-16(18(17)19-23-25-26-24-19)15-6-4-14(5-7-15)12-21-8-10-27-11-9-22-13-27/h1-7,9,11,21-22H,8,10,12-13H2,(H2,20,28,29)(H,23,24,25,26) |
| InChIKey | ZMJLFLGNMWQVTI-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 141.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|