C19H22N8O2S — CID 118257502
4-[4-[3-sulfamoyl-2-(2H-tetrazol-5-yl)phenyl]phenyl]piperidine-1-carboximidamide (PubChem CID 118257502) has the molecular formula C19H22N8O2S and a molecular weight of 426.51 g/mol. Its IUPAC name is 4-[4-[3-sulfamoyl-2-(2H-tetrazol-5-yl)phenyl]phenyl]piperidine-1-carboximidamide.
| Compound Name | 4-[4-[3-sulfamoyl-2-(2H-tetrazol-5-yl)phenyl]phenyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 118257502 |
| Molecular Formula | C19H22N8O2S |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 4-[4-[3-sulfamoyl-2-(2H-tetrazol-5-yl)phenyl]phenyl]piperidine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CCC(c2ccc(-c3cccc(S(N)(=O)=O)c3-c3nn[nH]n3)cc2)CC1 |
| InChI | InChI=1S/C19H22N8O2S/c20-19(21)27-10-8-13(9-11-27)12-4-6-14(7-5-12)15-2-1-3-16(30(22,28)29)17(15)18-23-25-26-24-18/h1-7,13H,8-11H2,(H3,20,21)(H2,22,28,29)(H,23,24,25,26) |
| InChIKey | JQIUUFBZZQXBLH-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 167.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|