C50H41N5O5 — CID 57046690
1-propanoyloxyethyl 2-cyclopropyl-3-[4-[2-(2-trityltetrazol-5-yl)phenyl]phenoxy]quinoline-4-carboxylate (PubChem CID 57046690) has the molecular formula C50H41N5O5 and a molecular weight of 791.91 g/mol. Its IUPAC name is 1-propanoyloxyethyl 2-cyclopropyl-3-[4-[2-(2-trityltetrazol-5-yl)phenyl]phenoxy]quinoline-4-carboxylate.
| Compound Name | 1-propanoyloxyethyl 2-cyclopropyl-3-[4-[2-(2-trityltetrazol-5-yl)phenyl]phenoxy]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 57046690 |
| Molecular Formula | C50H41N5O5 |
| Molecular Weight | 791.91 g/mol |
| Exact Mass | 791.31 |
| IUPAC Name | 1-propanoyloxyethyl 2-cyclopropyl-3-[4-[2-(2-trityltetrazol-5-yl)phenyl]phenoxy]quinoline-4-carboxylate |
| SMILES | CCC(=O)OC(C)OC(=O)c1c(Oc2ccc(-c3ccccc3-c3nnn(C(c4ccccc4)(c4ccccc4)c4ccccc4)n3)cc2)c(C2CC2)nc2ccccc12 |
| InChI | InChI=1S/C50H41N5O5/c1-3-44(56)58-33(2)59-49(57)45-42-25-15-16-26-43(42)51-46(35-27-28-35)47(45)60-39-31-29-34(30-32-39)40-23-13-14-24-41(40)48-52-54-55(53-48)50(36-17-7-4-8-18-36,37-19-9-5-10-20-37)38-21-11-6-12-22-38/h4-26,29-33,35H,3,27-28H2,1-2H3 |
| InChIKey | ZZOUAMWQVUZZQL-UHFFFAOYSA-N |
| XLogP | 10.52 |
| TPSA | 118.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.91 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|