C44H46N6O3 — CID 175499289
4-tert-butyl-N-[2-methoxy-4-(4-methoxyphenyl)-3-(2-trityltetrazol-5-yl)phenyl]piperidine-1-carboxamide (PubChem CID 175499289) has the molecular formula C44H46N6O3 and a molecular weight of 706.89 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-methoxy-4-(4-methoxyphenyl)-3-(2-trityltetrazol-5-yl)phenyl]piperidine-1-carboxamide.
| Compound Name | 4-tert-butyl-N-[2-methoxy-4-(4-methoxyphenyl)-3-(2-trityltetrazol-5-yl)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 175499289 |
| Molecular Formula | C44H46N6O3 |
| Molecular Weight | 706.89 g/mol |
| Exact Mass | 706.36 |
| IUPAC Name | 4-tert-butyl-N-[2-methoxy-4-(4-methoxyphenyl)-3-(2-trityltetrazol-5-yl)phenyl]piperidine-1-carboxamide |
| SMILES | COc1ccc(-c2ccc(NC(=O)N3CCC(C(C)(C)C)CC3)c(OC)c2-c2nnn(C(c3ccccc3)(c3ccccc3)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C44H46N6O3/c1-43(2,3)32-27-29-49(30-28-32)42(51)45-38-26-25-37(31-21-23-36(52-4)24-22-31)39(40(38)53-5)41-46-48-50(47-41)44(33-15-9-6-10-16-33,34-17-11-7-12-18-34)35-19-13-8-14-20-35/h6-26,32H,27-30H2,1-5H3,(H,45,51) |
| InChIKey | JTEXBRSVFJZJOH-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.89 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|