C40H36N6O — CID 154396351
2-butyl-3-[4-[2-(2-trityl-1,3-dihydrotetrazol-5-yl)phenyl]phenyl]imidazole-4-carbaldehyde (PubChem CID 154396351) has the molecular formula C40H36N6O and a molecular weight of 616.77 g/mol. Its IUPAC name is 2-butyl-3-[4-[2-(2-trityl-1,3-dihydrotetrazol-5-yl)phenyl]phenyl]imidazole-4-carbaldehyde.
| Compound Name | 2-butyl-3-[4-[2-(2-trityl-1,3-dihydrotetrazol-5-yl)phenyl]phenyl]imidazole-4-carbaldehyde |
|---|---|
| PubChem CID | 154396351 |
| Molecular Formula | C40H36N6O |
| Molecular Weight | 616.77 g/mol |
| Exact Mass | 616.30 |
| IUPAC Name | 2-butyl-3-[4-[2-(2-trityl-1,3-dihydrotetrazol-5-yl)phenyl]phenyl]imidazole-4-carbaldehyde |
| SMILES | CCCCc1ncc(C=O)n1-c1ccc(-c2ccccc2C2=NNN(C(c3ccccc3)(c3ccccc3)c3ccccc3)N2)cc1 |
| InChI | InChI=1S/C40H36N6O/c1-2-3-23-38-41-28-35(29-47)45(38)34-26-24-30(25-27-34)36-21-13-14-22-37(36)39-42-44-46(43-39)40(31-15-7-4-8-16-31,32-17-9-5-10-18-32)33-19-11-6-12-20-33/h4-22,24-29,44H,2-3,23H2,1H3,(H,42,43) |
| InChIKey | XFCVNBSAPYZUAD-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.77 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|