C28H26N6OS — CID 18962501
2-butyl-5-phenylsulfanyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carbaldehyde (PubChem CID 18962501) has the molecular formula C28H26N6OS and a molecular weight of 494.62 g/mol. Its IUPAC name is 2-butyl-5-phenylsulfanyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carbaldehyde.
| Compound Name | 2-butyl-5-phenylsulfanyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carbaldehyde |
|---|---|
| PubChem CID | 18962501 |
| Molecular Formula | C28H26N6OS |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | 2-butyl-5-phenylsulfanyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carbaldehyde |
| SMILES | CCCCc1nc(Sc2ccccc2)c(C=O)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C28H26N6OS/c1-2-3-13-26-29-28(36-22-9-5-4-6-10-22)25(19-35)34(26)18-20-14-16-21(17-15-20)23-11-7-8-12-24(23)27-30-32-33-31-27/h4-12,14-17,19H,2-3,13,18H2,1H3,(H,30,31,32,33) |
| InChIKey | WCXZQOOMDHGWIC-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|