C22H22ClN7 — CID 123138482
[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methanimine (PubChem CID 123138482) has the molecular formula C22H22ClN7 and a molecular weight of 419.92 g/mol. Its IUPAC name is [2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methanimine.
| Compound Name | [2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methanimine |
|---|---|
| PubChem CID | 123138482 |
| Molecular Formula | C22H22ClN7 |
| Molecular Weight | 419.92 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | [2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methanimine |
| SMILES | [H]/N=C/c1c(Cl)nc(CCCC)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C22H22ClN7/c1-2-3-8-20-25-21(23)19(13-24)30(20)14-15-9-11-16(12-10-15)17-6-4-5-7-18(17)22-26-28-29-27-22/h4-7,9-13,24H,2-3,8,14H2,1H3,(H,26,27,28,29)/b24-13+ |
| InChIKey | TXVRWCORDSRHRK-ZMOGYAJESA-N |
| XLogP | 4.77 |
| TPSA | 96.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.92 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|