C27H31N5O — CID 87130790
5-pentyl-3-propan-2-yl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]pyrrole-2-carbaldehyde (PubChem CID 87130790) has the molecular formula C27H31N5O and a molecular weight of 441.58 g/mol. Its IUPAC name is 5-pentyl-3-propan-2-yl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]pyrrole-2-carbaldehyde.
| Compound Name | 5-pentyl-3-propan-2-yl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]pyrrole-2-carbaldehyde |
|---|---|
| PubChem CID | 87130790 |
| Molecular Formula | C27H31N5O |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | 5-pentyl-3-propan-2-yl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]pyrrole-2-carbaldehyde |
| SMILES | CCCCCc1cc(C(C)C)c(C=O)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C27H31N5O/c1-4-5-6-9-22-16-25(19(2)3)26(18-33)32(22)17-20-12-14-21(15-13-20)23-10-7-8-11-24(23)27-28-30-31-29-27/h7-8,10-16,18-19H,4-6,9,17H2,1-3H3,(H,28,29,30,31) |
| InChIKey | MVWHXCROUOJEFZ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|