C27H32N6O2 — CID 19740776
1-butanoyl-4-hexyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-2-one (PubChem CID 19740776) has the molecular formula C27H32N6O2 and a molecular weight of 472.59 g/mol. Its IUPAC name is 1-butanoyl-4-hexyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-2-one.
| Compound Name | 1-butanoyl-4-hexyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-2-one |
|---|---|
| PubChem CID | 19740776 |
| Molecular Formula | C27H32N6O2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | 1-butanoyl-4-hexyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-2-one |
| SMILES | CCCCCCc1cn(C(=O)CCC)c(=O)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C27H32N6O2/c1-3-5-6-7-11-22-19-33(25(34)10-4-2)27(35)32(22)18-20-14-16-21(17-15-20)23-12-8-9-13-24(23)26-28-30-31-29-26/h8-9,12-17,19H,3-7,10-11,18H2,1-2H3,(H,28,29,30,31) |
| InChIKey | SVNAUYCMZRZBED-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|