About 3H-dioxatrisilole;9-(4-fluorophenyl)acridine
3H-dioxatrisilole;9-(4-fluorophenyl)acridine (PubChem CID 161091415) has the molecular formula C19H16FNO2Si3
and a molecular weight of 393.60 g/mol. Its IUPAC name is 3H-dioxatrisilole;9-(4-fluorophenyl)acridine.
Molecular Properties
| Compound Name | 3H-dioxatrisilole;9-(4-fluorophenyl)acridine |
| PubChem CID | 161091415 |
| Molecular Formula | C19H16FNO2Si3 |
| Molecular Weight | 393.60 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | 3H-dioxatrisilole;9-(4-fluorophenyl)acridine |
| SMILES | Fc1ccc(-c2c3ccccc3nc3ccccc23)cc1.O1O[SiH2][SiH]=[SiH]1 |
| InChI | InChI=1S/C19H12FN.H4O2Si3/c20-14-11-9-13(10-12-14)19-15-5-1-3-7-17(15)21-18-8-4-2-6-16(18)19;1-2-4-5-3-1/h1-12H;3,5H,4H2 |
| InChIKey | UHFNYOJXGFYHTP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.60 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 3H-dioxatrisilole;9-(4-fluorophenyl)acridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-dioxatrisilole;9-(4-fluorophenyl)acridine?
The IUPAC name of 3H-dioxatrisilole;9-(4-fluorophenyl)acridine (CID 161091415) is 3H-dioxatrisilole;9-(4-fluorophenyl)acridine.
What is the SMILES notation for 3H-dioxatrisilole;9-(4-fluorophenyl)acridine?
The canonical SMILES for 3H-dioxatrisilole;9-(4-fluorophenyl)acridine is Fc1ccc(-c2c3ccccc3nc3ccccc23)cc1.O1O[SiH2][SiH]=[SiH]1.
What is the InChIKey of 3H-dioxatrisilole;9-(4-fluorophenyl)acridine?
The InChIKey is UHFNYOJXGFYHTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12FN.H4O2Si3/c20-14-11-9-13(10-12-14)19-15-5-1-3-7-17(15)21-18-8-4-2-6-16(18)19;1-2-4-5-3-1/h1-12H;3,5H,4H2.
What are the key properties of 3H-dioxatrisilole;9-(4-fluorophenyl)acridine?
3H-dioxatrisilole;9-(4-fluorophenyl)acridine has a molecular weight of 393.60 g/mol, XLogP of 2.84, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-dioxatrisilole;9-(4-fluorophenyl)acridine is sourced from PubChem (CID 161091415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).