About 1,3-dihydroimidazole-2-thione;9-phenylacridine
1,3-dihydroimidazole-2-thione;9-phenylacridine (PubChem CID 88528417) has the molecular formula C22H17N3S
and a molecular weight of 355.47 g/mol. Its IUPAC name is 1,3-dihydroimidazole-2-thione;9-phenylacridine.
Molecular Properties
| Compound Name | 1,3-dihydroimidazole-2-thione;9-phenylacridine |
| PubChem CID | 88528417 |
| Molecular Formula | C22H17N3S |
| Molecular Weight | 355.47 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 1,3-dihydroimidazole-2-thione;9-phenylacridine |
| SMILES | S=c1[nH]cc[nH]1.c1ccc(-c2c3ccccc3nc3ccccc23)cc1 |
| InChI | InChI=1S/C19H13N.C3H4N2S/c1-2-8-14(9-3-1)19-15-10-4-6-12-17(15)20-18-13-7-5-11-16(18)19;6-3-4-1-2-5-3/h1-13H;1-2H,(H2,4,5,6) |
| InChIKey | PUNXKOVMFHRCCX-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.47 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dihydroimidazole-2-thione;9-phenylacridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dihydroimidazole-2-thione;9-phenylacridine?
The IUPAC name of 1,3-dihydroimidazole-2-thione;9-phenylacridine (CID 88528417) is 1,3-dihydroimidazole-2-thione;9-phenylacridine.
What is the SMILES notation for 1,3-dihydroimidazole-2-thione;9-phenylacridine?
The canonical SMILES for 1,3-dihydroimidazole-2-thione;9-phenylacridine is S=c1[nH]cc[nH]1.c1ccc(-c2c3ccccc3nc3ccccc23)cc1.
What is the InChIKey of 1,3-dihydroimidazole-2-thione;9-phenylacridine?
The InChIKey is PUNXKOVMFHRCCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13N.C3H4N2S/c1-2-8-14(9-3-1)19-15-10-4-6-12-17(15)20-18-13-7-5-11-16(18)19;6-3-4-1-2-5-3/h1-13H;1-2H,(H2,4,5,6).
What are the key properties of 1,3-dihydroimidazole-2-thione;9-phenylacridine?
1,3-dihydroimidazole-2-thione;9-phenylacridine has a molecular weight of 355.47 g/mol, XLogP of 6.13, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dihydroimidazole-2-thione;9-phenylacridine is sourced from PubChem (CID 88528417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).