C22H17N3S — CID 88528417
1,3-dihydroimidazole-2-thione;9-phenylacridine (PubChem CID 88528417) has the molecular formula C22H17N3S and a molecular weight of 355.47 g/mol. Its IUPAC name is 1,3-dihydroimidazole-2-thione;9-phenylacridine.
| Compound Name | 1,3-dihydroimidazole-2-thione;9-phenylacridine |
|---|---|
| PubChem CID | 88528417 |
| Molecular Formula | C22H17N3S |
| Molecular Weight | 355.47 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 1,3-dihydroimidazole-2-thione;9-phenylacridine |
| SMILES | S=c1[nH]cc[nH]1.c1ccc(-c2c3ccccc3nc3ccccc23)cc1 |
| InChI | InChI=1S/C19H13N.C3H4N2S/c1-2-8-14(9-3-1)19-15-10-4-6-12-17(15)20-18-13-7-5-11-16(18)19;6-3-4-1-2-5-3/h1-13H;1-2H,(H2,4,5,6) |
| InChIKey | PUNXKOVMFHRCCX-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.47 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|