About 9-phenylacridin-4-ol
9-phenylacridin-4-ol (PubChem CID 59256664) has the molecular formula C19H13NO
and a molecular weight of 271.32 g/mol. Its IUPAC name is 9-phenylacridin-4-ol.
Molecular Properties
| Compound Name | 9-phenylacridin-4-ol |
| PubChem CID | 59256664 |
| Molecular Formula | C19H13NO |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 9-phenylacridin-4-ol |
| SMILES | Oc1cccc2c(-c3ccccc3)c3ccccc3nc12 |
| InChI | InChI=1S/C19H13NO/c21-17-12-6-10-15-18(13-7-2-1-3-8-13)14-9-4-5-11-16(14)20-19(15)17/h1-12,21H |
| InChIKey | OKOSDOBYZQPACP-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 9-phenylacridin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-phenylacridin-4-ol?
The IUPAC name of 9-phenylacridin-4-ol (CID 59256664) is 9-phenylacridin-4-ol.
What is the SMILES notation for 9-phenylacridin-4-ol?
The canonical SMILES for 9-phenylacridin-4-ol is Oc1cccc2c(-c3ccccc3)c3ccccc3nc12.
What is the InChIKey of 9-phenylacridin-4-ol?
The InChIKey is OKOSDOBYZQPACP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13NO/c21-17-12-6-10-15-18(13-7-2-1-3-8-13)14-9-4-5-11-16(14)20-19(15)17/h1-12,21H.
What are the key properties of 9-phenylacridin-4-ol?
9-phenylacridin-4-ol has a molecular weight of 271.32 g/mol, XLogP of 4.76, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-phenylacridin-4-ol is sourced from PubChem (CID 59256664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).