About 9-aminoacridin-4-ol;(Z)-but-2-enedioic acid
9-aminoacridin-4-ol;(Z)-but-2-enedioic acid (PubChem CID 45105090) has the molecular formula C17H14N2O5
and a molecular weight of 326.31 g/mol. Its IUPAC name is 9-aminoacridin-4-ol;(Z)-but-2-enedioic acid.
Molecular Properties
| Compound Name | 9-aminoacridin-4-ol;(Z)-but-2-enedioic acid |
| PubChem CID | 45105090 |
| Molecular Formula | C17H14N2O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 9-aminoacridin-4-ol;(Z)-but-2-enedioic acid |
| SMILES | Nc1c2ccccc2nc2c(O)cccc12.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C13H10N2O.C4H4O4/c14-12-8-4-1-2-6-10(8)15-13-9(12)5-3-7-11(13)16;5-3(6)1-2-4(7)8/h1-7,16H,(H2,14,15);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | YYJSZOXETTWVOZ-BTJKTKAUSA-N |
| XLogP | 2.39 |
| TPSA | 133.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 9-aminoacridin-4-ol;(Z)-but-2-enedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-aminoacridin-4-ol;(Z)-but-2-enedioic acid?
The IUPAC name of 9-aminoacridin-4-ol;(Z)-but-2-enedioic acid (CID 45105090) is 9-aminoacridin-4-ol;(Z)-but-2-enedioic acid.
What is the SMILES notation for 9-aminoacridin-4-ol;(Z)-but-2-enedioic acid?
The canonical SMILES for 9-aminoacridin-4-ol;(Z)-but-2-enedioic acid is Nc1c2ccccc2nc2c(O)cccc12.O=C(O)/C=C\C(=O)O.
What is the InChIKey of 9-aminoacridin-4-ol;(Z)-but-2-enedioic acid?
The InChIKey is YYJSZOXETTWVOZ-BTJKTKAUSA-N. The full InChI is InChI=1S/C13H10N2O.C4H4O4/c14-12-8-4-1-2-6-10(8)15-13-9(12)5-3-7-11(13)16;5-3(6)1-2-4(7)8/h1-7,16H,(H2,14,15);1-2H,(H,5,6)(H,7,8)/b;2-1-.
What are the key properties of 9-aminoacridin-4-ol;(Z)-but-2-enedioic acid?
9-aminoacridin-4-ol;(Z)-but-2-enedioic acid has a molecular weight of 326.31 g/mol, XLogP of 2.39, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-aminoacridin-4-ol;(Z)-but-2-enedioic acid is sourced from PubChem (CID 45105090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).