About 2,4-dibromoquinazolin-8-ol
2,4-dibromoquinazolin-8-ol (PubChem CID 175262476) has the molecular formula C8H4Br2N2O
and a molecular weight of 303.94 g/mol. Its IUPAC name is 2,4-dibromoquinazolin-8-ol.
Molecular Properties
| Compound Name | 2,4-dibromoquinazolin-8-ol |
| PubChem CID | 175262476 |
| Molecular Formula | C8H4Br2N2O |
| Molecular Weight | 303.94 g/mol |
| Exact Mass | 301.87 |
| IUPAC Name | 2,4-dibromoquinazolin-8-ol |
| SMILES | Oc1cccc2c(Br)nc(Br)nc12 |
| InChI | InChI=1S/C8H4Br2N2O/c9-7-4-2-1-3-5(13)6(4)11-8(10)12-7/h1-3,13H |
| InChIKey | DPPSUBSVIYKSOQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.94 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dibromoquinazolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dibromoquinazolin-8-ol?
The IUPAC name of 2,4-dibromoquinazolin-8-ol (CID 175262476) is 2,4-dibromoquinazolin-8-ol.
What is the SMILES notation for 2,4-dibromoquinazolin-8-ol?
The canonical SMILES for 2,4-dibromoquinazolin-8-ol is Oc1cccc2c(Br)nc(Br)nc12.
What is the InChIKey of 2,4-dibromoquinazolin-8-ol?
The InChIKey is DPPSUBSVIYKSOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4Br2N2O/c9-7-4-2-1-3-5(13)6(4)11-8(10)12-7/h1-3,13H.
What are the key properties of 2,4-dibromoquinazolin-8-ol?
2,4-dibromoquinazolin-8-ol has a molecular weight of 303.94 g/mol, XLogP of 2.86, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dibromoquinazolin-8-ol is sourced from PubChem (CID 175262476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).