C17H11N3S — CID 14690224
10-phenyl-2H-pyridazino[4,5-b]quinoline-1-thione (PubChem CID 14690224) has the molecular formula C17H11N3S and a molecular weight of 289.36 g/mol. Its IUPAC name is 10-phenyl-2H-pyridazino[4,5-b]quinoline-1-thione.
| Compound Name | 10-phenyl-2H-pyridazino[4,5-b]quinoline-1-thione |
|---|---|
| PubChem CID | 14690224 |
| Molecular Formula | C17H11N3S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 10-phenyl-2H-pyridazino[4,5-b]quinoline-1-thione |
| SMILES | S=c1[nH]ncc2nc3ccccc3c(-c3ccccc3)c12 |
| InChI | InChI=1S/C17H11N3S/c21-17-16-14(10-18-20-17)19-13-9-5-4-8-12(13)15(16)11-6-2-1-3-7-11/h1-10H,(H,20,21) |
| InChIKey | MSQTUEBEJNFYQW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|