C26H37NO4 — CID 54395610
ethane;methyl (E)-5-hydroxy-3-oxo-7-(2,5,6-trimethyl-4-phenyl-3-pyridinyl)hept-6-enoate (PubChem CID 54395610) has the molecular formula C26H37NO4 and a molecular weight of 427.59 g/mol. Its IUPAC name is ethane;methyl (E)-5-hydroxy-3-oxo-7-(2,5,6-trimethyl-4-phenyl-3-pyridinyl)hept-6-enoate.
| Compound Name | ethane;methyl (E)-5-hydroxy-3-oxo-7-(2,5,6-trimethyl-4-phenyl-3-pyridinyl)hept-6-enoate |
|---|---|
| PubChem CID | 54395610 |
| Molecular Formula | C26H37NO4 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | ethane;methyl (E)-5-hydroxy-3-oxo-7-(2,5,6-trimethyl-4-phenyl-3-pyridinyl)hept-6-enoate |
| SMILES | CC.CC.COC(=O)CC(=O)CC(O)/C=C/c1c(C)nc(C)c(C)c1-c1ccccc1 |
| InChI | InChI=1S/C22H25NO4.2C2H6/c1-14-15(2)23-16(3)20(22(14)17-8-6-5-7-9-17)11-10-18(24)12-19(25)13-21(26)27-4;2*1-2/h5-11,18,24H,12-13H2,1-4H3;2*1-2H3/b11-10+;; |
| InChIKey | VJSGIIAORSYABB-BGNBUWATSA-N |
| XLogP | 5.62 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|