C27H27FO5 — CID 57205646
7-[2-tert-butyl-4-(4-fluorophenyl)-5-phenylfuran-3-yl]-5-hydroxy-3-oxohept-6-enoic acid (PubChem CID 57205646) has the molecular formula C27H27FO5 and a molecular weight of 450.51 g/mol. Its IUPAC name is 7-[2-tert-butyl-4-(4-fluorophenyl)-5-phenylfuran-3-yl]-5-hydroxy-3-oxohept-6-enoic acid.
| Compound Name | 7-[2-tert-butyl-4-(4-fluorophenyl)-5-phenylfuran-3-yl]-5-hydroxy-3-oxohept-6-enoic acid |
|---|---|
| PubChem CID | 57205646 |
| Molecular Formula | C27H27FO5 |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 7-[2-tert-butyl-4-(4-fluorophenyl)-5-phenylfuran-3-yl]-5-hydroxy-3-oxohept-6-enoic acid |
| SMILES | CC(C)(C)c1oc(-c2ccccc2)c(-c2ccc(F)cc2)c1C=CC(O)CC(=O)CC(=O)O |
| InChI | InChI=1S/C27H27FO5/c1-27(2,3)26-22(14-13-20(29)15-21(30)16-23(31)32)24(17-9-11-19(28)12-10-17)25(33-26)18-7-5-4-6-8-18/h4-14,20,29H,15-16H2,1-3H3,(H,31,32) |
| InChIKey | SZAIQQSVWQEVPX-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|