C23H23FN2O4 — CID 67920775
7-[2-(4-fluorophenyl)-4-propan-2-ylpyrrolo[1,2-b]pyridazin-3-yl]-5-hydroxy-3-oxohept-6-enoic acid (PubChem CID 67920775) has the molecular formula C23H23FN2O4 and a molecular weight of 410.45 g/mol. Its IUPAC name is 7-[2-(4-fluorophenyl)-4-propan-2-ylpyrrolo[1,2-b]pyridazin-3-yl]-5-hydroxy-3-oxohept-6-enoic acid.
| Compound Name | 7-[2-(4-fluorophenyl)-4-propan-2-ylpyrrolo[1,2-b]pyridazin-3-yl]-5-hydroxy-3-oxohept-6-enoic acid |
|---|---|
| PubChem CID | 67920775 |
| Molecular Formula | C23H23FN2O4 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 7-[2-(4-fluorophenyl)-4-propan-2-ylpyrrolo[1,2-b]pyridazin-3-yl]-5-hydroxy-3-oxohept-6-enoic acid |
| SMILES | CC(C)c1c(C=CC(O)CC(=O)CC(=O)O)c(-c2ccc(F)cc2)nn2cccc12 |
| InChI | InChI=1S/C23H23FN2O4/c1-14(2)22-19(10-9-17(27)12-18(28)13-21(29)30)23(15-5-7-16(24)8-6-15)25-26-11-3-4-20(22)26/h3-11,14,17,27H,12-13H2,1-2H3,(H,29,30) |
| InChIKey | GZUSBDKNQGHSMW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 91.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|