C24H27FO5 — CID 22404331
(E)-7-[2-(4-fluorophenyl)-3-methoxy-4-methyl-6-propan-2-ylphenyl]-5-hydroxy-3-oxohept-6-enoic acid (PubChem CID 22404331) has the molecular formula C24H27FO5 and a molecular weight of 414.47 g/mol. Its IUPAC name is (E)-7-[2-(4-fluorophenyl)-3-methoxy-4-methyl-6-propan-2-ylphenyl]-5-hydroxy-3-oxohept-6-enoic acid.
| Compound Name | (E)-7-[2-(4-fluorophenyl)-3-methoxy-4-methyl-6-propan-2-ylphenyl]-5-hydroxy-3-oxohept-6-enoic acid |
|---|---|
| PubChem CID | 22404331 |
| Molecular Formula | C24H27FO5 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | (E)-7-[2-(4-fluorophenyl)-3-methoxy-4-methyl-6-propan-2-ylphenyl]-5-hydroxy-3-oxohept-6-enoic acid |
| SMILES | COc1c(C)cc(C(C)C)c(/C=C/C(O)CC(=O)CC(=O)O)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C24H27FO5/c1-14(2)21-11-15(3)24(30-4)23(16-5-7-17(25)8-6-16)20(21)10-9-18(26)12-19(27)13-22(28)29/h5-11,14,18,26H,12-13H2,1-4H3,(H,28,29)/b10-9+ |
| InChIKey | FHEVLJQIVFXBLV-MDZDMXLPSA-N |
| XLogP | 4.74 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|