C25H29FO7 — CID 22404247
(E)-7-[2-(4-fluorophenyl)-4-(2-hydroxyethoxy)-3-methoxy-6-propan-2-ylphenyl]-5-hydroxy-3-oxohept-6-enoic acid (PubChem CID 22404247) has the molecular formula C25H29FO7 and a molecular weight of 460.50 g/mol. Its IUPAC name is (E)-7-[2-(4-fluorophenyl)-4-(2-hydroxyethoxy)-3-methoxy-6-propan-2-ylphenyl]-5-hydroxy-3-oxohept-6-enoic acid.
| Compound Name | (E)-7-[2-(4-fluorophenyl)-4-(2-hydroxyethoxy)-3-methoxy-6-propan-2-ylphenyl]-5-hydroxy-3-oxohept-6-enoic acid |
|---|---|
| PubChem CID | 22404247 |
| Molecular Formula | C25H29FO7 |
| Molecular Weight | 460.50 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | (E)-7-[2-(4-fluorophenyl)-4-(2-hydroxyethoxy)-3-methoxy-6-propan-2-ylphenyl]-5-hydroxy-3-oxohept-6-enoic acid |
| SMILES | COc1c(OCCO)cc(C(C)C)c(/C=C/C(O)CC(=O)CC(=O)O)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C25H29FO7/c1-15(2)21-14-22(33-11-10-27)25(32-3)24(16-4-6-17(26)7-5-16)20(21)9-8-18(28)12-19(29)13-23(30)31/h4-9,14-15,18,27-28H,10-13H2,1-3H3,(H,30,31)/b9-8+ |
| InChIKey | YXNMESDQGYPFEL-CMDGGOBGSA-N |
| XLogP | 3.80 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|