C21H22FNO3 — CID 54555875
3-[2-(4-fluorophenyl)-4-(2-hydroxyethoxy)-3-methoxy-6-propan-2-ylphenyl]prop-2-enenitrile (PubChem CID 54555875) has the molecular formula C21H22FNO3 and a molecular weight of 355.41 g/mol. Its IUPAC name is 3-[2-(4-fluorophenyl)-4-(2-hydroxyethoxy)-3-methoxy-6-propan-2-ylphenyl]prop-2-enenitrile.
| Compound Name | 3-[2-(4-fluorophenyl)-4-(2-hydroxyethoxy)-3-methoxy-6-propan-2-ylphenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 54555875 |
| Molecular Formula | C21H22FNO3 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 3-[2-(4-fluorophenyl)-4-(2-hydroxyethoxy)-3-methoxy-6-propan-2-ylphenyl]prop-2-enenitrile |
| SMILES | COc1c(OCCO)cc(C(C)C)c(C=CC#N)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C21H22FNO3/c1-14(2)18-13-19(26-12-11-24)21(25-3)20(17(18)5-4-10-23)15-6-8-16(22)9-7-15/h4-9,13-14,24H,11-12H2,1-3H3 |
| InChIKey | ZNDFBITVRVLCRF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|