C18H19FO3 — CID 23352384
2-(4-fluorophenyl)-3,4-dimethoxy-6-propan-2-ylbenzaldehyde (PubChem CID 23352384) has the molecular formula C18H19FO3 and a molecular weight of 302.35 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-3,4-dimethoxy-6-propan-2-ylbenzaldehyde.
| Compound Name | 2-(4-fluorophenyl)-3,4-dimethoxy-6-propan-2-ylbenzaldehyde |
|---|---|
| PubChem CID | 23352384 |
| Molecular Formula | C18H19FO3 |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 2-(4-fluorophenyl)-3,4-dimethoxy-6-propan-2-ylbenzaldehyde |
| SMILES | COc1cc(C(C)C)c(C=O)c(-c2ccc(F)cc2)c1OC |
| InChI | InChI=1S/C18H19FO3/c1-11(2)14-9-16(21-3)18(22-4)17(15(14)10-20)12-5-7-13(19)8-6-12/h5-11H,1-4H3 |
| InChIKey | LTFJGPQLAPQPKC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|