C20H20FNO4 — CID 67808580
7-[4-(4-fluorophenyl)-2,6-dimethyl-3-pyridinyl]-5-hydroxy-3-oxohept-6-enoic acid (PubChem CID 67808580) has the molecular formula C20H20FNO4 and a molecular weight of 357.38 g/mol. Its IUPAC name is 7-[4-(4-fluorophenyl)-2,6-dimethyl-3-pyridinyl]-5-hydroxy-3-oxohept-6-enoic acid.
| Compound Name | 7-[4-(4-fluorophenyl)-2,6-dimethyl-3-pyridinyl]-5-hydroxy-3-oxohept-6-enoic acid |
|---|---|
| PubChem CID | 67808580 |
| Molecular Formula | C20H20FNO4 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 7-[4-(4-fluorophenyl)-2,6-dimethyl-3-pyridinyl]-5-hydroxy-3-oxohept-6-enoic acid |
| SMILES | Cc1cc(-c2ccc(F)cc2)c(C=CC(O)CC(=O)CC(=O)O)c(C)n1 |
| InChI | InChI=1S/C20H20FNO4/c1-12-9-19(14-3-5-15(21)6-4-14)18(13(2)22-12)8-7-16(23)10-17(24)11-20(25)26/h3-9,16,23H,10-11H2,1-2H3,(H,25,26) |
| InChIKey | RJMZSKLGGXJZSJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|