C24H24FN3O4 — CID 19900535
(E)-7-[5-(4-fluorophenyl)-3-propan-2-yl-1-pyridin-2-ylpyrazol-4-yl]-5-hydroxy-3-oxohept-6-enoic acid (PubChem CID 19900535) has the molecular formula C24H24FN3O4 and a molecular weight of 437.47 g/mol. Its IUPAC name is (E)-7-[5-(4-fluorophenyl)-3-propan-2-yl-1-pyridin-2-ylpyrazol-4-yl]-5-hydroxy-3-oxohept-6-enoic acid.
| Compound Name | (E)-7-[5-(4-fluorophenyl)-3-propan-2-yl-1-pyridin-2-ylpyrazol-4-yl]-5-hydroxy-3-oxohept-6-enoic acid |
|---|---|
| PubChem CID | 19900535 |
| Molecular Formula | C24H24FN3O4 |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | (E)-7-[5-(4-fluorophenyl)-3-propan-2-yl-1-pyridin-2-ylpyrazol-4-yl]-5-hydroxy-3-oxohept-6-enoic acid |
| SMILES | CC(C)c1nn(-c2ccccn2)c(-c2ccc(F)cc2)c1/C=C/C(O)CC(=O)CC(=O)O |
| InChI | InChI=1S/C24H24FN3O4/c1-15(2)23-20(11-10-18(29)13-19(30)14-22(31)32)24(16-6-8-17(25)9-7-16)28(27-23)21-5-3-4-12-26-21/h3-12,15,18,29H,13-14H2,1-2H3,(H,31,32)/b11-10+ |
| InChIKey | RAGWCOGKABEACK-ZHACJKMWSA-N |
| XLogP | 4.00 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|